Template:Infobox mineral/doc: Difference between revisions
>I2Overcome m removed category |
(No difference)
|
Latest revision as of 07:15, 11 March 2025
| File:Edit-copy green.svg | This is a documentation subpage for Template:Infobox mineral. It may contain usage information, categories and other content that is not part of the original template page. |
| File:Lua-Logo.svg | This template uses Lua: |
This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.
| {{{name}}} | |
|---|---|
| [[File:{{{image}}}|{{{imagesize}}}|alt={{{alt}}}]] {{{caption}}} | |
| General | |
| Category | {{{category}}} |
| Formula | {{{formula}}} |
| IMA symbol | {{{IMAsymbol}}} |
| Strunz classification | {{{strunz}}} |
| Dana classification | {{{dana}}} |
| Crystal system | {{{system}}} |
| Crystal class | {{{class}}} |
| Space group | {{{symmetry}}} |
| Unit cell | {{{unit cell}}} |
| Structure | |
| [[File:{{{struct image}}}|{{{struct imagesize}}}|alt={{{struct alt}}}]]
{{{struct caption}}} | |
| [[File:{{{struct2 image}}}|{{{struct2 imagesize}}}|alt={{{struct2 alt}}}]]
{{{struct2 caption}}} | |
| Jmol (3D) | Interactive image |
| Identification | |
| Formula mass | {{{molweight}}} |
| Colour | {{{color}}}{{{colour}}} |
| Crystal habit | {{{habit}}} |
| Twinning | {{{twinning}}} |
| Cleavage | {{{cleavage}}} |
| Fracture | {{{fracture}}} |
| Tenacity | {{{tenacity}}} |
| Mohs scale hardness | {{{mohs}}} |
| Lustre | {{{luster}}} |
| Streak | {{{streak}}} |
| Diaphaneity | {{{diaphaneity}}} |
| Specific gravity | {{{gravity}}} |
| Density | {{{density}}} |
| Polish lustre | {{{polish}}} |
| Optical properties | {{{opticalprop}}} |
| Refractive index | {{{refractive}}} |
| Birefringence | {{{birefringence}}} |
| Pleochroism | {{{pleochroism}}} |
| 2V angle | {{{2V}}} |
| Dispersion | {{{dispersion}}} |
| Extinction | {{{extinction}}} |
| Length fast/slow | {{{length fast/slow}}} |
| Ultraviolet fluorescence | {{{fluorescence}}} |
| Absorption spectra | {{{absorption}}} |
| Melting point | {{{melt}}} |
| Fusibility | {{{fusibility}}} |
| Diagnostic features | {{{diagnostic}}} |
| Solubility | {{{solubility}}} |
| Common impurities | {{{impurities}}} |
| Alters to | {{{alteration}}} |
| Other characteristics | {{{other}}} |
| {{{prop1}}} | {{{prop1text}}} |
| References | {{{references}}} |
| Piezoelectric | {{{piezo}}} |
| Major varieties | |
| {{{var1}}} | {{{var1text}}} |
| {{{var2}}} | {{{var2text}}} |
| {{{var3}}} | {{{var3text}}} |
| {{{var4}}} | {{{var4text}}} |
| {{{var5}}} | {{{var5text}}} |
| {{{var6}}} | {{{var6text}}} |
Usage
Most field names are in lowercase.
Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.
| Ruby | |
|---|---|
| File:Ruby cristal.jpg A naturally occurring ruby crystal | |
| General | |
| Category | Oxide minerals, corundum variety |
| Formula | aluminium oxide with chromium, Al2O3:Cr |
| Crystal system | Trigonal |
| Crystal class | Hexagonal scalenohedral (3m) H-M symbol: (3 2/m) |
| Space group | R3c (No. 167) |
| Unit cell | unit cell |
| Identification | |
| Color | Red, may be brownish, purplish or pinkish |
| Crystal habit | Varies with locality. Terminated tabular hexagonal prisms. |
| Cleavage | No true cleavage |
| Fracture | Uneven or conchoidal |
| Mohs scale hardness | 9.0 |
| Luster | Vitreous |
| Streak | white |
| Diaphaneity | transparent |
| Specific gravity | 4.0 |
| Refractive index | nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008 |
| Pleochroism | Orangey red, purplish red |
| Ultraviolet fluorescence | red under longwave |
| Melting point | 2044 °C |
| Solubility | none |
| Major varieties | |
| Sapphire | Any color except red and violet |
| Oriental amethyst | violet color |
| Corundum | various colors (mineral species) |
| Emery | Granular (mineral mixture) |
{{Infobox mineral
| name =
| boxwidth =
| boxbgcolor =
| image =
| imagesize =
| alt =
| caption =
| struct image =
| struct caption =
| struct imagesize =
| struct2 image =
| struct2 caption =
| struct2 imagesize=
| SMILES =
| Jmol =
| category =
| formula =
| IMAsymbol =
| molweight =
| strunz =
| dana =
| system =
| class =
| symmetry =
| unit cell =
| color =
| colour =
| habit =
| twinning =
| cleavage =
| fracture =
| tenacity =
| mohs =
| luster =
| streak =
| diaphaneity =
| gravity =
| density =
| polish =
| opticalprop =
| refractive =
| birefringence =
| pleochroism =
| 2V =
| dispersion =
| extinction =
| length fast/slow =
| fluorescence =
| absorption =
| melt =
| Curie temp =
| fusibility =
| diagnostic =
| solubility =
| impurities =
| alteration =
| other =
| prop1 =
| prop1text =
| references =
| var1 =
| var1text =
| var2 =
| var2text =
| var3 =
| var3text =
| var4 =
| var4text =
| var5 =
| var5text =
| var6 =
| var6text =
}}
All parameters used
| name | |
|---|---|
| alt caption | |
| General | |
| Category | category |
| Formula | formula |
| IMA symbol | IMAsymbol |
| Strunz classification | strunz |
| Dana classification | dana |
| Crystal system | system |
| Crystal class | class |
| Space group | symmetry |
| Unit cell | unit cell |
| Structure | |
| File:A-tridymite.png
Crystal structure of α-tridymite | |
| File:Diamond lattice.stl
Some other image | |
| Jmol (3D) | Interactive image |
| Identification | |
| Formula mass | molweight |
| Colour | colorcolour |
| Crystal habit | habit |
| Twinning | twinning |
| Cleavage | cleavage |
| Fracture | fracture |
| Tenacity | tenacity |
| Mohs scale hardness | mohs |
| Lustre | luster |
| Streak | streak |
| Diaphaneity | diaphaneity |
| Specific gravity | gravity |
| Density | density |
| Polish lustre | polish |
| Optical properties | opticalprop |
| Refractive index | refractive |
| Birefringence | birefringence |
| Pleochroism | pleochroism |
| 2V angle | 2V |
| Dispersion | dispersion |
| Extinction | extinction |
| Length fast/slow | length fast/slow |
| Ultraviolet fluorescence | fluorescence |
| Absorption spectra | absorption |
| Melting point | melt |
| Fusibility | fusibility |
| Diagnostic features | diagnostic |
| Solubility | solubility |
| Common impurities | impurities |
| Alters to | alteration |
| Other characteristics | other |
| prop1 | prop1text |
| References | references |
| Major varieties | |
| var1 | var1text |
| var2 | var2text |
| var3 | var3text |
| var4 | var4text |
| var5 | var5text |
| var6 | var6text |
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize = 260px
|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px
|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow
| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| IMAsymbol = IMAsymbol
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text
Description
This should describe the parameters used in this template.
| Parameter | Explanation | Example |
|---|---|---|
| name | IMA mineral name (if there is another common name, put it in parentheses) | Baryte (Barite) |
| boxwidth | ||
| boxbgcolor | Background color of box headers | |
| boxtextcolor | Text color of box headers | |
| image | Wikimedia Commons image filename (to go at top) | Epidoto.jpeg |
| imagesize | ||
| alt | alt text for image, for visually impaired readers; see WP:ALT | Agglomeration of dark cylindrical crystals |
| caption | image caption | Epidote crystals |
| category | list broadest mineral group first (capitalized), followed by "minerals" (plural), then other groups, subgroups, and/or series name (if applicable), then mineral species name (if article topic is a mineral variety); separate with commas; add links manually for each category and the first occurrences of the words: "minerals", "group" or "subgroup" (link to Mineral group), "variety" (link to Mineral variety) (template does not auto-link) | For Fairburn Agate: [[Tectosilicate]] [[minerals]], [[quartz]] [[Mineral group|group]], [[chalcedony]] [[Mineral variety|variety]], [[agate]] variety |
| formula | chemical formula giving the elemental composition of the mineral, or a generic formula for a mineral group; use for complex formulas | BaSO4 |
| IMAsymbol | IMA symbol of the mineral | Brt |
| strunz | Nickel-Strunz classification of the mineral (10 ed, MinDat) | 9.BG.05 |
| dana | Dana classification of the mineral | 28.03.01.01 |
| symmetry | Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group | |
| unit cell | Unit cell dimensions and number (Z) of formula units per unit cell | |
| molweight | molar mass of the chemical formula above | |
| color | common colors of the mineral | |
| colour | same as above, but for British pages | |
| habit | common mineral habit | |
| system | crystal system (cubic, etc.) | |
| class | crystal class | |
| twinning | common type of twinning | |
| cleavage | type of cleavage | |
| fracture | type of fracture (appearance of broken surface) | irregular |
| tenacity | tenacity (how the mineral can deform or break) | brittle |
| mohs | hardness (scratchability) of mineral on Mohs hardness scale | 3-3.5 |
| luster | way the mineral reflects light, see luster | |
| lustre | same as above, but for British pages | |
| streak | see streak | |
| diaphaneity | transparency of mineral | |
| gravity | specific gravity | |
| density | density at STP in g/cm3 | |
| polish | ability to take a polish | |
| opticalprop | ||
| refractive | refractive index of mineral | |
| birefringence | birefringence of a 30micron thin section | |
| pleochroism | see pleochroism | |
| 2V | 2V angle | |
| dispersion | see dispersion | |
| extinction | extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals). | |
| length fast/slow | Sign of elongation: length fast or length slow | |
| fluorescence | see fluorescence | |
| absorption | see absorption | |
| melt | melting point of mineral | |
| Curie | Curie temperature of mineral | |
| fusibility | fusibility of mineral | |
| diagnostic | key way to recognize mineral | |
| solubility | solubility of mineral in water at STP | |
| impurities | common impurities | |
| alteration | alteration products | |
| other | ||
| prop1 | ||
| prop1text | ||
| references | use the Wikipedia template:ref to cite | References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed. |
| var1 | ||
| var1text | ||
| var2 | ||
| var2text | ||
| var3 | ||
| var3text | ||
| var4 | ||
| var4text | ||
| var5 | ||
| var5text | ||
| var6 | ||
| var6text |
TemplateData
TemplateData for Infobox mineral
No description.
| Parameter | Description | Type | Status | |
|---|---|---|---|---|
| boxwidth | boxwidth | no description | Unknown | optional |
| boxtextcolor | boxtextcolor | no description | Unknown | optional |
| boxbgcolor | boxbgcolor | no description | Unknown | optional |
| name | name | no description | Unknown | optional |
| image | image | no description | Unknown | optional |
| imagesize | imagesize | no description | Unknown | optional |
| alt | alt | no description | Unknown | optional |
| caption | caption | no description | Unknown | optional |
| category | category | no description | Unknown | optional |
| formula | formula | no description | Unknown | optional |
| IMAsymbol | IMAsymbol | no description | Unknown | optional |
| strunz | strunz | no description | Unknown | optional |
| system | system | no description | Unknown | optional |
| dana | dana | no description | Unknown | optional |
| class | class | no description | Unknown | optional |
| symmetry | symmetry | no description | Unknown | optional |
| unit cell | unit cell | no description | Unknown | optional |
| molweight | molweight | no description | Unknown | optional |
| color | color | no description | Unknown | optional |
| habit | habit | no description | Unknown | optional |
| twinning | twinning | no description | Unknown | optional |
| cleavage | cleavage | no description | Unknown | optional |
| fracture | fracture | no description | Unknown | optional |
| tenacity | tenacity | no description | Unknown | optional |
| mohs | mohs | no description | Unknown | optional |
| luster | luster | no description | Unknown | optional |
| polish | polish | no description | Unknown | optional |
| opticalprop | opticalprop | no description | Unknown | optional |
| refractive | refractive | no description | Unknown | optional |
| birefringence | birefringence | no description | Unknown | optional |
| pleochroism | pleochroism | no description | Unknown | optional |
| 2V | 2V | no description | Unknown | optional |
| dispersion | dispersion | no description | Unknown | optional |
| extinction | extinction | no description | Unknown | optional |
| length fast/slow | length fast/slow | no description | Unknown | optional |
| fluorescence | fluorescence | no description | Unknown | optional |
| absorption | absorption | no description | Unknown | optional |
| streak | streak | no description | Unknown | optional |
| gravity | gravity | no description | Unknown | optional |
| density | density | no description | Unknown | optional |
| melt | melt | no description | Unknown | optional |
| fusibility | fusibility | no description | Unknown | optional |
| diagnostic | diagnostic | no description | Unknown | optional |
| solubility | solubility | no description | Unknown | optional |
| diaphaneity | diaphaneity | no description | Unknown | optional |
| impurities | impurities | no description | Unknown | optional |
| alteration | alteration | no description | Unknown | optional |
| other | other | no description | Unknown | optional |
| prop1text | prop1text | no description | Unknown | optional |
| references | references | no description | Unknown | optional |
| colour | colour | no description | Unknown | optional |
| lustre | lustre | no description | Unknown | optional |
| polish lustre | polish lustre | no description | Unknown | optional |
| prop1 | prop1 | no description | Unknown | optional |
| var1 | var1 | no description | Unknown | optional |
| var1text | var1text | no description | Unknown | optional |
| var2 | var2 | no description | Unknown | optional |
| var2text | var2text | no description | Unknown | optional |
| var3 | var3 | no description | Unknown | optional |
| var3text | var3text | no description | Unknown | optional |
| var4 | var4 | no description | Unknown | optional |
| var4text | var4text | no description | Unknown | optional |
| var5 | var5 | no description | Unknown | optional |
| var5text | var5text | no description | Unknown | optional |
| var6 | var6 | no description | Unknown | optional |
| var6text | var6text | no description | Unknown | optional |
| struct image | struct image | no description | Unknown | optional |
| struct2 image | struct2 image | no description | Unknown | optional |
| struct caption | struct caption | no description | Unknown | optional |
| struct imagesize | struct imagesize | no description | Unknown | optional |
| struct alt | struct alt | no description | Unknown | optional |
| struct2 imagesize | struct2 imagesize | no description | Unknown | optional |
| struct2 caption | struct2 caption | no description | Unknown | optional |
| struct2 alt | struct2 alt | no description | Unknown | optional |
| Jmol | Jmol | no description | Unknown | optional |
| SMILES | SMILES | no description | Unknown | optional |
| piezo | piezo | no description | Unknown | optional |
Tracking category